C32H37N3O5 — CID 87580830
4-[(E)-3-[methyl(piperidin-4-yl)amino]-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]-N-(oxan-2-yloxy)benzamide (PubChem CID 87580830) has the molecular formula C32H37N3O5 and a molecular weight of 543.66 g/mol. Its IUPAC name is 4-[(E)-3-[methyl(piperidin-4-yl)amino]-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]-N-(oxan-2-yloxy)benzamide.
| Compound Name | 4-[(E)-3-[methyl(piperidin-4-yl)amino]-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]-N-(oxan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 87580830 |
| Molecular Formula | C32H37N3O5 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 4-[(E)-3-[methyl(piperidin-4-yl)amino]-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]-N-(oxan-2-yloxy)benzamide |
| SMILES | CN(C(=O)/C(=C/c1ccc(C(=O)NOC2CCCCO2)cc1)COc1cccc2ccccc12)C1CCNCC1 |
| InChI | InChI=1S/C32H37N3O5/c1-35(27-16-18-33-19-17-27)32(37)26(22-39-29-10-6-8-24-7-2-3-9-28(24)29)21-23-12-14-25(15-13-23)31(36)34-40-30-11-4-5-20-38-30/h2-3,6-10,12-15,21,27,30,33H,4-5,11,16-20,22H2,1H3,(H,34,36)/b26-21+ |
| InChIKey | KBCJVZGGMWUNSI-YYADALCUSA-N |
| XLogP | 4.70 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|