C32H47N3O5 — CID 90699569
N-[2-[di(propan-2-yl)amino]ethyl]-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide (PubChem CID 90699569) has the molecular formula C32H47N3O5 and a molecular weight of 553.74 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide |
|---|---|
| PubChem CID | 90699569 |
| Molecular Formula | C32H47N3O5 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.35 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide |
| SMILES | CC(C)N(CCNC(=O)C(=CCCCCC(=O)NOC1CCCCO1)COc1cccc2ccccc12)C(C)C |
| InChI | InChI=1S/C32H47N3O5/c1-24(2)35(25(3)4)21-20-33-32(37)27(23-39-29-17-12-15-26-13-8-9-16-28(26)29)14-6-5-7-18-30(36)34-40-31-19-10-11-22-38-31/h8-9,12-17,24-25,31H,5-7,10-11,18-23H2,1-4H3,(H,33,37)(H,34,36) |
| InChIKey | BPXKRPSLYHKGFV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|