C32H43N3O5 — CID 87225987
(E)-N-(1-cyclopropylpiperidin-4-yl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide (PubChem CID 87225987) has the molecular formula C32H43N3O5 and a molecular weight of 549.71 g/mol. Its IUPAC name is (E)-N-(1-cyclopropylpiperidin-4-yl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide.
| Compound Name | (E)-N-(1-cyclopropylpiperidin-4-yl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide |
|---|---|
| PubChem CID | 87225987 |
| Molecular Formula | C32H43N3O5 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | (E)-N-(1-cyclopropylpiperidin-4-yl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide |
| SMILES | O=C(CCCC/C=C(\COc1cccc2ccccc12)C(=O)NC1CCN(C2CC2)CC1)NOC1CCCCO1 |
| InChI | InChI=1S/C32H43N3O5/c36-30(34-40-31-15-6-7-22-38-31)14-3-1-2-10-25(23-39-29-13-8-11-24-9-4-5-12-28(24)29)32(37)33-26-18-20-35(21-19-26)27-16-17-27/h4-5,8-13,26-27,31H,1-3,6-7,14-23H2,(H,33,37)(H,34,36)/b25-10+ |
| InChIKey | XNCSNNKPWGLFHS-KIBLKLHPSA-N |
| XLogP | 5.02 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|