C30H40N2O4 — CID 66987647
methyl 8-[(1-cyclopentylpiperidin-4-yl)amino]-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate (PubChem CID 66987647) has the molecular formula C30H40N2O4 and a molecular weight of 492.66 g/mol. Its IUPAC name is methyl 8-[(1-cyclopentylpiperidin-4-yl)amino]-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate.
| Compound Name | methyl 8-[(1-cyclopentylpiperidin-4-yl)amino]-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate |
|---|---|
| PubChem CID | 66987647 |
| Molecular Formula | C30H40N2O4 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | methyl 8-[(1-cyclopentylpiperidin-4-yl)amino]-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate |
| SMILES | COC(=O)CCCCC=C(COc1cccc2ccccc12)C(=O)NC1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C30H40N2O4/c1-35-29(33)17-4-2-3-11-24(22-36-28-16-9-12-23-10-5-8-15-27(23)28)30(34)31-25-18-20-32(21-19-25)26-13-6-7-14-26/h5,8-12,15-16,25-26H,2-4,6-7,13-14,17-22H2,1H3,(H,31,34) |
| InChIKey | UELMSYOELVDQSB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|