C26H33NO4 — CID 66987722
methyl 8-(cyclohexylamino)-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate (PubChem CID 66987722) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is methyl 8-(cyclohexylamino)-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate.
| Compound Name | methyl 8-(cyclohexylamino)-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate |
|---|---|
| PubChem CID | 66987722 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | methyl 8-(cyclohexylamino)-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate |
| SMILES | COC(=O)CCCCC=C(COc1cccc2ccccc12)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C26H33NO4/c1-30-25(28)18-7-2-4-12-21(26(29)27-22-14-5-3-6-15-22)19-31-24-17-10-13-20-11-8-9-16-23(20)24/h8-13,16-17,22H,2-7,14-15,18-19H2,1H3,(H,27,29) |
| InChIKey | JQULEDVIIBSAPE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|