C26H35N3O4 — CID 90937867
N'-hydroxy-2-(naphthalen-1-yloxymethyl)-N-(1-propan-2-ylpyrrolidin-3-yl)oct-2-enediamide (PubChem CID 90937867) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is N'-hydroxy-2-(naphthalen-1-yloxymethyl)-N-(1-propan-2-ylpyrrolidin-3-yl)oct-2-enediamide.
| Compound Name | N'-hydroxy-2-(naphthalen-1-yloxymethyl)-N-(1-propan-2-ylpyrrolidin-3-yl)oct-2-enediamide |
|---|---|
| PubChem CID | 90937867 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | N'-hydroxy-2-(naphthalen-1-yloxymethyl)-N-(1-propan-2-ylpyrrolidin-3-yl)oct-2-enediamide |
| SMILES | CC(C)N1CCC(NC(=O)C(=CCCCCC(=O)NO)COc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C26H35N3O4/c1-19(2)29-16-15-22(17-29)27-26(31)21(10-4-3-5-14-25(30)28-32)18-33-24-13-8-11-20-9-6-7-12-23(20)24/h6-13,19,22,32H,3-5,14-18H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | LERXQMLCFARRIC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|