C32H45N3O5 — CID 87225825
(E)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)-N-(1-propan-2-ylpiperidin-4-yl)oct-2-enediamide (PubChem CID 87225825) has the molecular formula C32H45N3O5 and a molecular weight of 551.73 g/mol. Its IUPAC name is (E)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)-N-(1-propan-2-ylpiperidin-4-yl)oct-2-enediamide.
| Compound Name | (E)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)-N-(1-propan-2-ylpiperidin-4-yl)oct-2-enediamide |
|---|---|
| PubChem CID | 87225825 |
| Molecular Formula | C32H45N3O5 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | (E)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)-N-(1-propan-2-ylpiperidin-4-yl)oct-2-enediamide |
| SMILES | CC(C)N1CCC(NC(=O)/C(=C/CCCCC(=O)NOC2CCCCO2)COc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C32H45N3O5/c1-24(2)35-20-18-27(19-21-35)33-32(37)26(23-39-29-15-10-13-25-11-6-7-14-28(25)29)12-4-3-5-16-30(36)34-40-31-17-8-9-22-38-31/h6-7,10-15,24,27,31H,3-5,8-9,16-23H2,1-2H3,(H,33,37)(H,34,36)/b26-12+ |
| InChIKey | YLNLDPRBONHOCD-RPPGKUMJSA-N |
| XLogP | 5.27 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|