C29H34N2O6 — CID 91464786
N-(furan-2-ylmethyl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide (PubChem CID 91464786) has the molecular formula C29H34N2O6 and a molecular weight of 506.60 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide |
|---|---|
| PubChem CID | 91464786 |
| Molecular Formula | C29H34N2O6 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide |
| SMILES | O=C(CCCCC=C(COc1cccc2ccccc12)C(=O)NCc1ccco1)NOC1CCCCO1 |
| InChI | InChI=1S/C29H34N2O6/c32-27(31-37-28-17-6-7-18-35-28)16-3-1-2-11-23(29(33)30-20-24-13-9-19-34-24)21-36-26-15-8-12-22-10-4-5-14-25(22)26/h4-5,8-15,19,28H,1-3,6-7,16-18,20-21H2,(H,30,33)(H,31,32) |
| InChIKey | QRHKFXDRKZCAOI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|