C32H49N3O4 — CID 87587419
(E)-7-[[2-[di(propan-2-yl)amino]ethylamino]methyl]-8-naphthalen-1-yloxy-N-(oxan-2-yloxy)oct-6-enamide (PubChem CID 87587419) has the molecular formula C32H49N3O4 and a molecular weight of 539.76 g/mol. Its IUPAC name is (E)-7-[[2-[di(propan-2-yl)amino]ethylamino]methyl]-8-naphthalen-1-yloxy-N-(oxan-2-yloxy)oct-6-enamide.
| Compound Name | (E)-7-[[2-[di(propan-2-yl)amino]ethylamino]methyl]-8-naphthalen-1-yloxy-N-(oxan-2-yloxy)oct-6-enamide |
|---|---|
| PubChem CID | 87587419 |
| Molecular Formula | C32H49N3O4 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.37 |
| IUPAC Name | (E)-7-[[2-[di(propan-2-yl)amino]ethylamino]methyl]-8-naphthalen-1-yloxy-N-(oxan-2-yloxy)oct-6-enamide |
| SMILES | CC(C)N(CCNC/C(=C\CCCCC(=O)NOC1CCCCO1)COc1cccc2ccccc12)C(C)C |
| InChI | InChI=1S/C32H49N3O4/c1-25(2)35(26(3)4)21-20-33-23-27(24-38-30-17-12-15-28-14-8-9-16-29(28)30)13-6-5-7-18-31(36)34-39-32-19-10-11-22-37-32/h8-9,12-17,25-26,32-33H,5-7,10-11,18-24H2,1-4H3,(H,34,36)/b27-13+ |
| InChIKey | XGYAUWFNXHMGIR-UVHMKAGCSA-N |
| XLogP | 5.99 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|