C31H43N3O5 — CID 87226126
(Z)-7-(naphthalen-1-yloxymethyl)-N-(oxan-2-yloxy)-8-[3-(2-oxopyrrolidin-1-yl)propylamino]oct-6-enamide (PubChem CID 87226126) has the molecular formula C31H43N3O5 and a molecular weight of 537.70 g/mol. Its IUPAC name is (Z)-7-(naphthalen-1-yloxymethyl)-N-(oxan-2-yloxy)-8-[3-(2-oxopyrrolidin-1-yl)propylamino]oct-6-enamide.
| Compound Name | (Z)-7-(naphthalen-1-yloxymethyl)-N-(oxan-2-yloxy)-8-[3-(2-oxopyrrolidin-1-yl)propylamino]oct-6-enamide |
|---|---|
| PubChem CID | 87226126 |
| Molecular Formula | C31H43N3O5 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | (Z)-7-(naphthalen-1-yloxymethyl)-N-(oxan-2-yloxy)-8-[3-(2-oxopyrrolidin-1-yl)propylamino]oct-6-enamide |
| SMILES | O=C(CCCC/C=C(/CNCCCN1CCCC1=O)COc1cccc2ccccc12)NOC1CCCCO1 |
| InChI | InChI=1S/C31H43N3O5/c35-29(33-39-31-18-6-7-22-37-31)16-3-1-2-11-25(23-32-19-10-21-34-20-9-17-30(34)36)24-38-28-15-8-13-26-12-4-5-14-27(26)28/h4-5,8,11-15,31-32H,1-3,6-7,9-10,16-24H2,(H,33,35)/b25-11- |
| InChIKey | DZBVLKSMBHKPSU-GATIEOLUSA-N |
| XLogP | 4.88 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|