C29H37N3O7 — CID 87452619
3-[[(E)-2-(naphthalen-1-yloxymethyl)-8-(oxan-2-yloxyamino)-8-oxooct-2-enoyl]amino]pyrrolidine-1-carboxylic acid (PubChem CID 87452619) has the molecular formula C29H37N3O7 and a molecular weight of 539.63 g/mol. Its IUPAC name is 3-[[(E)-2-(naphthalen-1-yloxymethyl)-8-(oxan-2-yloxyamino)-8-oxooct-2-enoyl]amino]pyrrolidine-1-carboxylic acid.
| Compound Name | 3-[[(E)-2-(naphthalen-1-yloxymethyl)-8-(oxan-2-yloxyamino)-8-oxooct-2-enoyl]amino]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87452619 |
| Molecular Formula | C29H37N3O7 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | 3-[[(E)-2-(naphthalen-1-yloxymethyl)-8-(oxan-2-yloxyamino)-8-oxooct-2-enoyl]amino]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(CCCC/C=C(\COc1cccc2ccccc12)C(=O)NC1CCN(C(=O)O)C1)NOC1CCCCO1 |
| InChI | InChI=1S/C29H37N3O7/c33-26(31-39-27-15-6-7-18-37-27)14-3-1-2-10-22(28(34)30-23-16-17-32(19-23)29(35)36)20-38-25-13-8-11-21-9-4-5-12-24(21)25/h4-5,8-13,23,27H,1-3,6-7,14-20H2,(H,30,34)(H,31,33)(H,35,36)/b22-10+ |
| InChIKey | RTCURZKLGBYXMW-LSHDLFTRSA-N |
| XLogP | 4.15 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|