C31H43N3O5 — CID 87225890
(E)-N-(1-ethylpiperidin-4-yl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide (PubChem CID 87225890) has the molecular formula C31H43N3O5 and a molecular weight of 537.70 g/mol. Its IUPAC name is (E)-N-(1-ethylpiperidin-4-yl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide.
| Compound Name | (E)-N-(1-ethylpiperidin-4-yl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide |
|---|---|
| PubChem CID | 87225890 |
| Molecular Formula | C31H43N3O5 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | (E)-N-(1-ethylpiperidin-4-yl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide |
| SMILES | CCN1CCC(NC(=O)/C(=C/CCCCC(=O)NOC2CCCCO2)COc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C31H43N3O5/c1-2-34-20-18-26(19-21-34)32-31(36)25(23-38-28-15-10-13-24-11-6-7-14-27(24)28)12-4-3-5-16-29(35)33-39-30-17-8-9-22-37-30/h6-7,10-15,26,30H,2-5,8-9,16-23H2,1H3,(H,32,36)(H,33,35)/b25-12+ |
| InChIKey | UIGKJYYHKVLLBS-BRJLIKDPSA-N |
| XLogP | 4.88 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|