C31H45N3O5 — CID 87226114
(E)-N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide (PubChem CID 87226114) has the molecular formula C31H45N3O5 and a molecular weight of 539.72 g/mol. Its IUPAC name is (E)-N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide.
| Compound Name | (E)-N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide |
|---|---|
| PubChem CID | 87226114 |
| Molecular Formula | C31H45N3O5 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | (E)-N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide |
| SMILES | CN(C)CC(C)(C)CNC(=O)/C(=C/CCCCC(=O)NOC1CCCCO1)COc1cccc2ccccc12 |
| InChI | InChI=1S/C31H45N3O5/c1-31(2,23-34(3)4)22-32-30(36)25(21-38-27-17-12-15-24-13-8-9-16-26(24)27)14-6-5-7-18-28(35)33-39-29-19-10-11-20-37-29/h8-9,12-17,29H,5-7,10-11,18-23H2,1-4H3,(H,32,36)(H,33,35)/b25-14+ |
| InChIKey | VVWWCYKHDLOGDO-AFUMVMLFSA-N |
| XLogP | 4.98 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|