C32H42N2O5 — CID 87225864
(E)-N-(2-cyclohex-2-en-1-ylethyl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide (PubChem CID 87225864) has the molecular formula C32H42N2O5 and a molecular weight of 534.70 g/mol. Its IUPAC name is (E)-N-(2-cyclohex-2-en-1-ylethyl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide.
| Compound Name | (E)-N-(2-cyclohex-2-en-1-ylethyl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide |
|---|---|
| PubChem CID | 87225864 |
| Molecular Formula | C32H42N2O5 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | (E)-N-(2-cyclohex-2-en-1-ylethyl)-2-(naphthalen-1-yloxymethyl)-N'-(oxan-2-yloxy)oct-2-enediamide |
| SMILES | O=C(CCCC/C=C(\COc1cccc2ccccc12)C(=O)NCCC1C=CCCC1)NOC1CCCCO1 |
| InChI | InChI=1S/C32H42N2O5/c35-30(34-39-31-20-9-10-23-37-31)19-6-2-5-15-27(32(36)33-22-21-25-12-3-1-4-13-25)24-38-29-18-11-16-26-14-7-8-17-28(26)29/h3,7-8,11-12,14-18,25,31H,1-2,4-6,9-10,13,19-24H2,(H,33,36)(H,34,35)/b27-15+ |
| InChIKey | OCBRHGATRIZJAO-JFLMPSFJSA-N |
| XLogP | 6.14 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|