C31H42N2O4 — CID 66987282
methyl 8-[[1-(cyclohexylmethyl)pyrrolidin-3-yl]amino]-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate (PubChem CID 66987282) has the molecular formula C31H42N2O4 and a molecular weight of 506.69 g/mol. Its IUPAC name is methyl 8-[[1-(cyclohexylmethyl)pyrrolidin-3-yl]amino]-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate.
| Compound Name | methyl 8-[[1-(cyclohexylmethyl)pyrrolidin-3-yl]amino]-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate |
|---|---|
| PubChem CID | 66987282 |
| Molecular Formula | C31H42N2O4 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | methyl 8-[[1-(cyclohexylmethyl)pyrrolidin-3-yl]amino]-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate |
| SMILES | COC(=O)CCCCC=C(COc1cccc2ccccc12)C(=O)NC1CCN(CC2CCCCC2)C1 |
| InChI | InChI=1S/C31H42N2O4/c1-36-30(34)18-7-3-6-14-26(23-37-29-17-10-15-25-13-8-9-16-28(25)29)31(35)32-27-19-20-33(22-27)21-24-11-4-2-5-12-24/h8-10,13-17,24,27H,2-7,11-12,18-23H2,1H3,(H,32,35) |
| InChIKey | OVSSQJFSFDRFPZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|