C24H25NO5 — CID 141170931
methyl (E)-8-(furan-2-ylamino)-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate (PubChem CID 141170931) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is methyl (E)-8-(furan-2-ylamino)-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate.
| Compound Name | methyl (E)-8-(furan-2-ylamino)-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate |
|---|---|
| PubChem CID | 141170931 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | methyl (E)-8-(furan-2-ylamino)-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate |
| SMILES | COC(=O)CCCC/C=C(\COc1cccc2ccccc12)C(=O)Nc1ccco1 |
| InChI | InChI=1S/C24H25NO5/c1-28-23(26)15-4-2-3-10-19(24(27)25-22-14-8-16-29-22)17-30-21-13-7-11-18-9-5-6-12-20(18)21/h5-14,16H,2-4,15,17H2,1H3,(H,25,27)/b19-10+ |
| InChIKey | LIYOIWIJZORPOY-VXLYETTFSA-N |
| XLogP | 5.11 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|