C24H33NO4 — CID 66987341
methyl 7-[(1-methoxypropan-2-ylamino)methyl]-8-naphthalen-1-yloxyoct-6-enoate (PubChem CID 66987341) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is methyl 7-[(1-methoxypropan-2-ylamino)methyl]-8-naphthalen-1-yloxyoct-6-enoate.
| Compound Name | methyl 7-[(1-methoxypropan-2-ylamino)methyl]-8-naphthalen-1-yloxyoct-6-enoate |
|---|---|
| PubChem CID | 66987341 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | methyl 7-[(1-methoxypropan-2-ylamino)methyl]-8-naphthalen-1-yloxyoct-6-enoate |
| SMILES | COCC(C)NCC(=CCCCCC(=O)OC)COc1cccc2ccccc12 |
| InChI | InChI=1S/C24H33NO4/c1-19(17-27-2)25-16-20(10-5-4-6-15-24(26)28-3)18-29-23-14-9-12-21-11-7-8-13-22(21)23/h7-14,19,25H,4-6,15-18H2,1-3H3 |
| InChIKey | FHXNMFSBZRILHZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|