C26H37N3O4 — CID 167158499
(Z)-N-[4-(dimethylamino)butyl]-N'-hydroxy-3-(naphthalen-1-yloxymethyl)non-3-enediamide (PubChem CID 167158499) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is (Z)-N-[4-(dimethylamino)butyl]-N'-hydroxy-3-(naphthalen-1-yloxymethyl)non-3-enediamide.
| Compound Name | (Z)-N-[4-(dimethylamino)butyl]-N'-hydroxy-3-(naphthalen-1-yloxymethyl)non-3-enediamide |
|---|---|
| PubChem CID | 167158499 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | (Z)-N-[4-(dimethylamino)butyl]-N'-hydroxy-3-(naphthalen-1-yloxymethyl)non-3-enediamide |
| SMILES | CN(C)CCCCNC(=O)C/C(=C/CCCCC(=O)NO)COc1cccc2ccccc12 |
| InChI | InChI=1S/C26H37N3O4/c1-29(2)18-9-8-17-27-26(31)19-21(11-4-3-5-16-25(30)28-32)20-33-24-15-10-13-22-12-6-7-14-23(22)24/h6-7,10-15,32H,3-5,8-9,16-20H2,1-2H3,(H,27,31)(H,28,30)/b21-11- |
| InChIKey | RDQKOKMEUZNCBQ-NHDPSOOVSA-N |
| XLogP | 4.06 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|