C28H40N2O4 — CID 66987892
methyl (E)-8-[2-[di(propan-2-yl)amino]ethylamino]-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate (PubChem CID 66987892) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is methyl (E)-8-[2-[di(propan-2-yl)amino]ethylamino]-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate.
| Compound Name | methyl (E)-8-[2-[di(propan-2-yl)amino]ethylamino]-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate |
|---|---|
| PubChem CID | 66987892 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | methyl (E)-8-[2-[di(propan-2-yl)amino]ethylamino]-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoate |
| SMILES | COC(=O)CCCC/C=C(\COc1cccc2ccccc12)C(=O)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C28H40N2O4/c1-21(2)30(22(3)4)19-18-29-28(32)24(13-7-6-8-17-27(31)33-5)20-34-26-16-11-14-23-12-9-10-15-25(23)26/h9-16,21-22H,6-8,17-20H2,1-5H3,(H,29,32)/b24-13+ |
| InChIKey | LBSHHOQIDFNFJS-ZMOGYAJESA-N |
| XLogP | 5.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|