C25H32N2O4 — CID 141170930
(E)-7-(naphthalen-1-yloxymethyl)-8-oxo-8-(2-pyrrolidin-1-ylethylamino)oct-6-enoic acid (PubChem CID 141170930) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is (E)-7-(naphthalen-1-yloxymethyl)-8-oxo-8-(2-pyrrolidin-1-ylethylamino)oct-6-enoic acid.
| Compound Name | (E)-7-(naphthalen-1-yloxymethyl)-8-oxo-8-(2-pyrrolidin-1-ylethylamino)oct-6-enoic acid |
|---|---|
| PubChem CID | 141170930 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (E)-7-(naphthalen-1-yloxymethyl)-8-oxo-8-(2-pyrrolidin-1-ylethylamino)oct-6-enoic acid |
| SMILES | O=C(O)CCCC/C=C(\COc1cccc2ccccc12)C(=O)NCCN1CCCC1 |
| InChI | InChI=1S/C25H32N2O4/c28-24(29)14-3-1-2-10-21(25(30)26-15-18-27-16-6-7-17-27)19-31-23-13-8-11-20-9-4-5-12-22(20)23/h4-5,8-13H,1-3,6-7,14-19H2,(H,26,30)(H,28,29)/b21-10+ |
| InChIKey | MGBNYMHNCXUEOM-UFFVCSGVSA-N |
| XLogP | 4.00 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|