C26H36N2O3 — CID 66987025
2-methyl-7-(naphthalen-1-yloxymethyl)-8-(2-pyrrolidin-1-ylethylamino)oct-6-enoic acid (PubChem CID 66987025) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is 2-methyl-7-(naphthalen-1-yloxymethyl)-8-(2-pyrrolidin-1-ylethylamino)oct-6-enoic acid.
| Compound Name | 2-methyl-7-(naphthalen-1-yloxymethyl)-8-(2-pyrrolidin-1-ylethylamino)oct-6-enoic acid |
|---|---|
| PubChem CID | 66987025 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 2-methyl-7-(naphthalen-1-yloxymethyl)-8-(2-pyrrolidin-1-ylethylamino)oct-6-enoic acid |
| SMILES | CC(CCCC=C(CNCCN1CCCC1)COc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H36N2O3/c1-21(26(29)30)9-2-3-10-22(19-27-15-18-28-16-6-7-17-28)20-31-25-14-8-12-23-11-4-5-13-24(23)25/h4-5,8,10-14,21,27H,2-3,6-7,9,15-20H2,1H3,(H,29,30) |
| InChIKey | CHBVHZOOLCEEJW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|