C26H34N2O4 — CID 66987328
8-[(1-ethylpyrrolidin-3-yl)amino]-2-methyl-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoic acid (PubChem CID 66987328) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 8-[(1-ethylpyrrolidin-3-yl)amino]-2-methyl-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoic acid.
| Compound Name | 8-[(1-ethylpyrrolidin-3-yl)amino]-2-methyl-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoic acid |
|---|---|
| PubChem CID | 66987328 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 8-[(1-ethylpyrrolidin-3-yl)amino]-2-methyl-7-(naphthalen-1-yloxymethyl)-8-oxooct-6-enoic acid |
| SMILES | CCN1CCC(NC(=O)C(=CCCCC(C)C(=O)O)COc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C26H34N2O4/c1-3-28-16-15-22(17-28)27-25(29)21(11-5-4-9-19(2)26(30)31)18-32-24-14-8-12-20-10-6-7-13-23(20)24/h6-8,10-14,19,22H,3-5,9,15-18H2,1-2H3,(H,27,29)(H,30,31) |
| InChIKey | DDRQAFFSNLZSCI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|