C27H30FNO3 — CID 66987273
7-[[2-(4-fluorophenyl)ethylamino]methyl]-8-naphthalen-1-yloxyoct-6-enoic acid (PubChem CID 66987273) has the molecular formula C27H30FNO3 and a molecular weight of 435.54 g/mol. Its IUPAC name is 7-[[2-(4-fluorophenyl)ethylamino]methyl]-8-naphthalen-1-yloxyoct-6-enoic acid.
| Compound Name | 7-[[2-(4-fluorophenyl)ethylamino]methyl]-8-naphthalen-1-yloxyoct-6-enoic acid |
|---|---|
| PubChem CID | 66987273 |
| Molecular Formula | C27H30FNO3 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 7-[[2-(4-fluorophenyl)ethylamino]methyl]-8-naphthalen-1-yloxyoct-6-enoic acid |
| SMILES | O=C(O)CCCCC=C(CNCCc1ccc(F)cc1)COc1cccc2ccccc12 |
| InChI | InChI=1S/C27H30FNO3/c28-24-15-13-21(14-16-24)17-18-29-19-22(7-2-1-3-12-27(30)31)20-32-26-11-6-9-23-8-4-5-10-25(23)26/h4-11,13-16,29H,1-3,12,17-20H2,(H,30,31) |
| InChIKey | REQCIQYZTSYHLZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|