C27H29NO3 — CID 142687999
methyl 4-[(Z)-2-(naphthalen-1-yloxymethyl)-3-piperidin-1-ylprop-1-enyl]benzoate (PubChem CID 142687999) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is methyl 4-[(Z)-2-(naphthalen-1-yloxymethyl)-3-piperidin-1-ylprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(Z)-2-(naphthalen-1-yloxymethyl)-3-piperidin-1-ylprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 142687999 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | methyl 4-[(Z)-2-(naphthalen-1-yloxymethyl)-3-piperidin-1-ylprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(\COc2cccc3ccccc23)CN2CCCCC2)cc1 |
| InChI | InChI=1S/C27H29NO3/c1-30-27(29)24-14-12-21(13-15-24)18-22(19-28-16-5-2-6-17-28)20-31-26-11-7-9-23-8-3-4-10-25(23)26/h3-4,7-15,18H,2,5-6,16-17,19-20H2,1H3/b22-18- |
| InChIKey | OEYKCNSGGDAVJX-PYCFMQQDSA-N |
| XLogP | 5.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |