C28H32N2O3 — CID 66987208
4-[2-[[(1-ethylpiperidin-4-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoic acid (PubChem CID 66987208) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 4-[2-[[(1-ethylpiperidin-4-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoic acid.
| Compound Name | 4-[2-[[(1-ethylpiperidin-4-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 66987208 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 4-[2-[[(1-ethylpiperidin-4-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoic acid |
| SMILES | CCN1CCC(NCC(=Cc2ccc(C(=O)O)cc2)COc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C28H32N2O3/c1-2-30-16-14-25(15-17-30)29-19-22(18-21-10-12-24(13-11-21)28(31)32)20-33-27-9-5-7-23-6-3-4-8-26(23)27/h3-13,18,25,29H,2,14-17,19-20H2,1H3,(H,31,32) |
| InChIKey | OVTDZLYZZHATNV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |