C27H27N3O3 — CID 66987318
4-[2-[(3-imidazol-1-ylpropylamino)methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoic acid (PubChem CID 66987318) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-[2-[(3-imidazol-1-ylpropylamino)methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoic acid.
| Compound Name | 4-[2-[(3-imidazol-1-ylpropylamino)methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 66987318 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 4-[2-[(3-imidazol-1-ylpropylamino)methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=C(CNCCCn2ccnc2)COc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C27H27N3O3/c31-27(32)24-11-9-21(10-12-24)17-22(18-28-13-4-15-30-16-14-29-20-30)19-33-26-8-3-6-23-5-1-2-7-25(23)26/h1-3,5-12,14,16-17,20,28H,4,13,15,18-19H2,(H,31,32) |
| InChIKey | PAPLQBIRZGYSNJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|