C27H23ClN2O3 — CID 90902592
4-[2-[[(2-chloro-3-pyridinyl)amino]methyl]-4-naphthalen-1-yloxybut-1-enyl]benzoic acid (PubChem CID 90902592) has the molecular formula C27H23ClN2O3 and a molecular weight of 458.95 g/mol. Its IUPAC name is 4-[2-[[(2-chloro-3-pyridinyl)amino]methyl]-4-naphthalen-1-yloxybut-1-enyl]benzoic acid.
| Compound Name | 4-[2-[[(2-chloro-3-pyridinyl)amino]methyl]-4-naphthalen-1-yloxybut-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 90902592 |
| Molecular Formula | C27H23ClN2O3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 4-[2-[[(2-chloro-3-pyridinyl)amino]methyl]-4-naphthalen-1-yloxybut-1-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=C(CCOc2cccc3ccccc23)CNc2cccnc2Cl)cc1 |
| InChI | InChI=1S/C27H23ClN2O3/c28-26-24(8-4-15-29-26)30-18-20(17-19-10-12-22(13-11-19)27(31)32)14-16-33-25-9-3-6-21-5-1-2-7-23(21)25/h1-13,15,17,30H,14,16,18H2,(H,31,32) |
| InChIKey | BPQYCYLGTYZUFV-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|