C30H25N3O5S — CID 91599520
methyl 4-[4-naphthalen-1-yloxy-2-[[(6-nitro-1,3-benzothiazol-2-yl)amino]methyl]but-1-enyl]benzoate (PubChem CID 91599520) has the molecular formula C30H25N3O5S and a molecular weight of 539.61 g/mol. Its IUPAC name is methyl 4-[4-naphthalen-1-yloxy-2-[[(6-nitro-1,3-benzothiazol-2-yl)amino]methyl]but-1-enyl]benzoate.
| Compound Name | methyl 4-[4-naphthalen-1-yloxy-2-[[(6-nitro-1,3-benzothiazol-2-yl)amino]methyl]but-1-enyl]benzoate |
|---|---|
| PubChem CID | 91599520 |
| Molecular Formula | C30H25N3O5S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | methyl 4-[4-naphthalen-1-yloxy-2-[[(6-nitro-1,3-benzothiazol-2-yl)amino]methyl]but-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(C=C(CCOc2cccc3ccccc23)CNc2nc3ccc([N+](=O)[O-])cc3s2)cc1 |
| InChI | InChI=1S/C30H25N3O5S/c1-37-29(34)23-11-9-20(10-12-23)17-21(15-16-38-27-8-4-6-22-5-2-3-7-25(22)27)19-31-30-32-26-14-13-24(33(35)36)18-28(26)39-30/h2-14,17-18H,15-16,19H2,1H3,(H,31,32) |
| InChIKey | OSHUSNQDFJZALP-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|