C31H29N3O3S — CID 87894878
4-[(E)-2-[[(5,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]-4-naphthalen-1-yloxybut-1-enyl]-N-hydroxybenzamide (PubChem CID 87894878) has the molecular formula C31H29N3O3S and a molecular weight of 523.66 g/mol. Its IUPAC name is 4-[(E)-2-[[(5,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]-4-naphthalen-1-yloxybut-1-enyl]-N-hydroxybenzamide.
| Compound Name | 4-[(E)-2-[[(5,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]-4-naphthalen-1-yloxybut-1-enyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 87894878 |
| Molecular Formula | C31H29N3O3S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 4-[(E)-2-[[(5,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]-4-naphthalen-1-yloxybut-1-enyl]-N-hydroxybenzamide |
| SMILES | Cc1cc2nc(NC/C(=C/c3ccc(C(=O)NO)cc3)CCOc3cccc4ccccc34)sc2cc1C |
| InChI | InChI=1S/C31H29N3O3S/c1-20-16-27-29(17-21(20)2)38-31(33-27)32-19-23(18-22-10-12-25(13-11-22)30(35)34-36)14-15-37-28-9-5-7-24-6-3-4-8-26(24)28/h3-13,16-18,36H,14-15,19H2,1-2H3,(H,32,33)(H,34,35)/b23-18+ |
| InChIKey | AVSHIVOKKJESJY-PTGBLXJZSA-N |
| XLogP | 7.15 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|