C30H25N3O3 — CID 11540152
N-hydroxy-4-[(E)-2-(naphthalen-1-yloxymethyl)-3-(quinolin-3-ylamino)prop-1-enyl]benzamide (PubChem CID 11540152) has the molecular formula C30H25N3O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-hydroxy-4-[(E)-2-(naphthalen-1-yloxymethyl)-3-(quinolin-3-ylamino)prop-1-enyl]benzamide.
| Compound Name | N-hydroxy-4-[(E)-2-(naphthalen-1-yloxymethyl)-3-(quinolin-3-ylamino)prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 11540152 |
| Molecular Formula | C30H25N3O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-hydroxy-4-[(E)-2-(naphthalen-1-yloxymethyl)-3-(quinolin-3-ylamino)prop-1-enyl]benzamide |
| SMILES | O=C(NO)c1ccc(/C=C(\CNc2cnc3ccccc3c2)COc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C30H25N3O3/c34-30(33-35)24-14-12-21(13-15-24)16-22(18-31-26-17-25-7-2-4-10-28(25)32-19-26)20-36-29-11-5-8-23-6-1-3-9-27(23)29/h1-17,19,31,35H,18,20H2,(H,33,34)/b22-16+ |
| InChIKey | JHYHYDVDGKRDCH-CJLVFECKSA-N |
| XLogP | 6.08 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|