C32H28N2O3 — CID 173185485
N-hydroxy-4-[4-hydroxy-4-naphthalen-1-yl-2-[(naphthalen-2-ylamino)methyl]but-1-enyl]benzamide (PubChem CID 173185485) has the molecular formula C32H28N2O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-hydroxy-4-[4-hydroxy-4-naphthalen-1-yl-2-[(naphthalen-2-ylamino)methyl]but-1-enyl]benzamide.
| Compound Name | N-hydroxy-4-[4-hydroxy-4-naphthalen-1-yl-2-[(naphthalen-2-ylamino)methyl]but-1-enyl]benzamide |
|---|---|
| PubChem CID | 173185485 |
| Molecular Formula | C32H28N2O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | N-hydroxy-4-[4-hydroxy-4-naphthalen-1-yl-2-[(naphthalen-2-ylamino)methyl]but-1-enyl]benzamide |
| SMILES | O=C(NO)c1ccc(C=C(CNc2ccc3ccccc3c2)CC(O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C32H28N2O3/c35-31(30-11-5-9-25-7-3-4-10-29(25)30)19-23(18-22-12-14-26(15-13-22)32(36)34-37)21-33-28-17-16-24-6-1-2-8-27(24)20-28/h1-18,20,31,33,35,37H,19,21H2,(H,34,36) |
| InChIKey | GAZVQAVHFUSYCZ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|