C27H30N2O3 — CID 11495705
4-[(Z)-2-[(cyclopentylamino)methyl]-4-naphthalen-1-yloxybut-1-enyl]-N-hydroxybenzamide (PubChem CID 11495705) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 4-[(Z)-2-[(cyclopentylamino)methyl]-4-naphthalen-1-yloxybut-1-enyl]-N-hydroxybenzamide.
| Compound Name | 4-[(Z)-2-[(cyclopentylamino)methyl]-4-naphthalen-1-yloxybut-1-enyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 11495705 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 4-[(Z)-2-[(cyclopentylamino)methyl]-4-naphthalen-1-yloxybut-1-enyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(/C=C(/CCOc2cccc3ccccc23)CNC2CCCC2)cc1 |
| InChI | InChI=1S/C27H30N2O3/c30-27(29-31)23-14-12-20(13-15-23)18-21(19-28-24-8-2-3-9-24)16-17-32-26-11-5-7-22-6-1-4-10-25(22)26/h1,4-7,10-15,18,24,28,31H,2-3,8-9,16-17,19H2,(H,29,30)/b21-18- |
| InChIKey | ONFNSJXQBCPSHQ-UZYVYHOESA-N |
| XLogP | 5.34 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|