C30H26N2O4 — CID 73048640
N-hydroxy-4-[4-naphthalen-1-yloxy-2-[(2-oxo-3H-indol-1-yl)methyl]but-1-enyl]benzamide (PubChem CID 73048640) has the molecular formula C30H26N2O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-hydroxy-4-[4-naphthalen-1-yloxy-2-[(2-oxo-3H-indol-1-yl)methyl]but-1-enyl]benzamide.
| Compound Name | N-hydroxy-4-[4-naphthalen-1-yloxy-2-[(2-oxo-3H-indol-1-yl)methyl]but-1-enyl]benzamide |
|---|---|
| PubChem CID | 73048640 |
| Molecular Formula | C30H26N2O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-hydroxy-4-[4-naphthalen-1-yloxy-2-[(2-oxo-3H-indol-1-yl)methyl]but-1-enyl]benzamide |
| SMILES | O=C(NO)c1ccc(C=C(CCOc2cccc3ccccc23)CN2C(=O)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C30H26N2O4/c33-29-19-25-7-2-4-10-27(25)32(29)20-22(18-21-12-14-24(15-13-21)30(34)31-35)16-17-36-28-11-5-8-23-6-1-3-9-26(23)28/h1-15,18,35H,16-17,19-20H2,(H,31,34) |
| InChIKey | BOIBRPOMXLUHKS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|