C29H33N3O3 — CID 74349235
4-[2-[[(1-cyclopropylpiperidin-4-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]-N-hydroxybenzamide (PubChem CID 74349235) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is 4-[2-[[(1-cyclopropylpiperidin-4-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]-N-hydroxybenzamide.
| Compound Name | 4-[2-[[(1-cyclopropylpiperidin-4-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 74349235 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 4-[2-[[(1-cyclopropylpiperidin-4-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(C=C(CNC2CCN(C3CC3)CC2)COc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C29H33N3O3/c33-29(31-34)24-10-8-21(9-11-24)18-22(19-30-25-14-16-32(17-15-25)26-12-13-26)20-35-28-7-3-5-23-4-1-2-6-27(23)28/h1-11,18,25-26,30,34H,12-17,19-20H2,(H,31,33) |
| InChIKey | STIXIOQBKPPIPN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|