C34H30N2O3 — CID 11598751
N-hydroxy-4-[(Z)-4-naphthalen-1-yloxy-2-[(4-phenylanilino)methyl]but-1-enyl]benzamide (PubChem CID 11598751) has the molecular formula C34H30N2O3 and a molecular weight of 514.63 g/mol. Its IUPAC name is N-hydroxy-4-[(Z)-4-naphthalen-1-yloxy-2-[(4-phenylanilino)methyl]but-1-enyl]benzamide.
| Compound Name | N-hydroxy-4-[(Z)-4-naphthalen-1-yloxy-2-[(4-phenylanilino)methyl]but-1-enyl]benzamide |
|---|---|
| PubChem CID | 11598751 |
| Molecular Formula | C34H30N2O3 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | N-hydroxy-4-[(Z)-4-naphthalen-1-yloxy-2-[(4-phenylanilino)methyl]but-1-enyl]benzamide |
| SMILES | O=C(NO)c1ccc(/C=C(/CCOc2cccc3ccccc23)CNc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C34H30N2O3/c37-34(36-38)30-15-13-25(14-16-30)23-26(21-22-39-33-12-6-10-29-9-4-5-11-32(29)33)24-35-31-19-17-28(18-20-31)27-7-2-1-3-8-27/h1-20,23,35,38H,21-22,24H2,(H,36,37)/b26-23- |
| InChIKey | ANHZUODGPOIRMT-RWEWTDSWSA-N |
| XLogP | 7.59 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|