C29H27ClN2O5 — CID 11642114
4-[(E)-2-[(4-chloronaphthalen-1-yl)oxymethyl]-3-(3,4-dimethoxyanilino)prop-1-enyl]-N-hydroxybenzamide (PubChem CID 11642114) has the molecular formula C29H27ClN2O5 and a molecular weight of 519.00 g/mol. Its IUPAC name is 4-[(E)-2-[(4-chloronaphthalen-1-yl)oxymethyl]-3-(3,4-dimethoxyanilino)prop-1-enyl]-N-hydroxybenzamide.
| Compound Name | 4-[(E)-2-[(4-chloronaphthalen-1-yl)oxymethyl]-3-(3,4-dimethoxyanilino)prop-1-enyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 11642114 |
| Molecular Formula | C29H27ClN2O5 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 4-[(E)-2-[(4-chloronaphthalen-1-yl)oxymethyl]-3-(3,4-dimethoxyanilino)prop-1-enyl]-N-hydroxybenzamide |
| SMILES | COc1ccc(NC/C(=C\c2ccc(C(=O)NO)cc2)COc2ccc(Cl)c3ccccc23)cc1OC |
| InChI | InChI=1S/C29H27ClN2O5/c1-35-27-13-11-22(16-28(27)36-2)31-17-20(15-19-7-9-21(10-8-19)29(33)32-34)18-37-26-14-12-25(30)23-5-3-4-6-24(23)26/h3-16,31,34H,17-18H2,1-2H3,(H,32,33)/b20-15+ |
| InChIKey | VRWZTJVOOWTSRD-HMMYKYKNSA-N |
| XLogP | 6.20 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|