C30H28ClNO5 — CID 143194983
methyl 4-[(E)-2-[(4-chloronaphthalen-1-yl)oxymethyl]-3-(3,4-dimethoxyanilino)prop-1-enyl]benzoate (PubChem CID 143194983) has the molecular formula C30H28ClNO5 and a molecular weight of 518.01 g/mol. Its IUPAC name is methyl 4-[(E)-2-[(4-chloronaphthalen-1-yl)oxymethyl]-3-(3,4-dimethoxyanilino)prop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-2-[(4-chloronaphthalen-1-yl)oxymethyl]-3-(3,4-dimethoxyanilino)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 143194983 |
| Molecular Formula | C30H28ClNO5 |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | methyl 4-[(E)-2-[(4-chloronaphthalen-1-yl)oxymethyl]-3-(3,4-dimethoxyanilino)prop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(\CNc2ccc(OC)c(OC)c2)COc2ccc(Cl)c3ccccc23)cc1 |
| InChI | InChI=1S/C30H28ClNO5/c1-34-28-14-12-23(17-29(28)35-2)32-18-21(16-20-8-10-22(11-9-20)30(33)36-3)19-37-27-15-13-26(31)24-6-4-5-7-25(24)27/h4-17,32H,18-19H2,1-3H3/b21-16+ |
| InChIKey | HYPGJAAEVDWWBE-LTGZKZEYSA-N |
| XLogP | 6.87 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|