C30H29NO4 — CID 91299887
methyl 4-[2-[(N-ethyl-2-hydroxyanilino)methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoate (PubChem CID 91299887) has the molecular formula C30H29NO4 and a molecular weight of 467.57 g/mol. Its IUPAC name is methyl 4-[2-[(N-ethyl-2-hydroxyanilino)methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoate.
| Compound Name | methyl 4-[2-[(N-ethyl-2-hydroxyanilino)methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 91299887 |
| Molecular Formula | C30H29NO4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | methyl 4-[2-[(N-ethyl-2-hydroxyanilino)methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoate |
| SMILES | CCN(CC(=Cc1ccc(C(=O)OC)cc1)COc1cccc2ccccc12)c1ccccc1O |
| InChI | InChI=1S/C30H29NO4/c1-3-31(27-12-6-7-13-28(27)32)20-23(19-22-15-17-25(18-16-22)30(33)34-2)21-35-29-14-8-10-24-9-4-5-11-26(24)29/h4-19,32H,3,20-21H2,1-2H3 |
| InChIKey | KLQZPVDIDQHIEI-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |