C22H19BrO3 — CID 59245026
methyl 4-[(E)-2-(bromomethyl)-3-naphthalen-1-yloxyprop-1-enyl]benzoate (PubChem CID 59245026) has the molecular formula C22H19BrO3 and a molecular weight of 411.30 g/mol. Its IUPAC name is methyl 4-[(E)-2-(bromomethyl)-3-naphthalen-1-yloxyprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-2-(bromomethyl)-3-naphthalen-1-yloxyprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 59245026 |
| Molecular Formula | C22H19BrO3 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | methyl 4-[(E)-2-(bromomethyl)-3-naphthalen-1-yloxyprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(/CBr)COc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H19BrO3/c1-25-22(24)19-11-9-16(10-12-19)13-17(14-23)15-26-21-8-4-6-18-5-2-3-7-20(18)21/h2-13H,14-15H2,1H3/b17-13- |
| InChIKey | PXEWOJDADOKRKX-LGMDPLHJSA-N |
| XLogP | 5.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|