C27H25N3O3S — CID 11684264
N-hydroxy-4-[(E)-2-[(3-methoxyphenyl)sulfanylmethyl]-3-(quinolin-3-ylamino)prop-1-enyl]benzamide (PubChem CID 11684264) has the molecular formula C27H25N3O3S and a molecular weight of 471.58 g/mol. Its IUPAC name is N-hydroxy-4-[(E)-2-[(3-methoxyphenyl)sulfanylmethyl]-3-(quinolin-3-ylamino)prop-1-enyl]benzamide.
| Compound Name | N-hydroxy-4-[(E)-2-[(3-methoxyphenyl)sulfanylmethyl]-3-(quinolin-3-ylamino)prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 11684264 |
| Molecular Formula | C27H25N3O3S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-hydroxy-4-[(E)-2-[(3-methoxyphenyl)sulfanylmethyl]-3-(quinolin-3-ylamino)prop-1-enyl]benzamide |
| SMILES | COc1cccc(SC/C(=C/c2ccc(C(=O)NO)cc2)CNc2cnc3ccccc3c2)c1 |
| InChI | InChI=1S/C27H25N3O3S/c1-33-24-6-4-7-25(15-24)34-18-20(13-19-9-11-21(12-10-19)27(31)30-32)16-28-23-14-22-5-2-3-8-26(22)29-17-23/h2-15,17,28,32H,16,18H2,1H3,(H,30,31)/b20-13+ |
| InChIKey | CGKHNRRXUMMVOQ-DEDYPNTBSA-N |
| XLogP | 5.65 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|