C37H46N2O6 — CID 173036420
(1-tert-butylcyclohexyl)-[2-(naphthalen-1-yloxymethyl)-3-[4-(oxan-2-yloxycarbamoyl)phenyl]prop-2-enyl]carbamic acid (PubChem CID 173036420) has the molecular formula C37H46N2O6 and a molecular weight of 614.78 g/mol. Its IUPAC name is (1-tert-butylcyclohexyl)-[2-(naphthalen-1-yloxymethyl)-3-[4-(oxan-2-yloxycarbamoyl)phenyl]prop-2-enyl]carbamic acid.
| Compound Name | (1-tert-butylcyclohexyl)-[2-(naphthalen-1-yloxymethyl)-3-[4-(oxan-2-yloxycarbamoyl)phenyl]prop-2-enyl]carbamic acid |
|---|---|
| PubChem CID | 173036420 |
| Molecular Formula | C37H46N2O6 |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.34 |
| IUPAC Name | (1-tert-butylcyclohexyl)-[2-(naphthalen-1-yloxymethyl)-3-[4-(oxan-2-yloxycarbamoyl)phenyl]prop-2-enyl]carbamic acid |
| SMILES | CC(C)(C)C1(N(CC(=Cc2ccc(C(=O)NOC3CCCCO3)cc2)COc2cccc3ccccc23)C(=O)O)CCCCC1 |
| InChI | InChI=1S/C37H46N2O6/c1-36(2,3)37(21-8-4-9-22-37)39(35(41)42)25-28(26-44-32-15-11-13-29-12-5-6-14-31(29)32)24-27-17-19-30(20-18-27)34(40)38-45-33-16-7-10-23-43-33/h5-6,11-15,17-20,24,33H,4,7-10,16,21-23,25-26H2,1-3H3,(H,38,40)(H,41,42) |
| InChIKey | ZBKIHMJVKILSCN-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|