C17H21F3N4O — CID 142672745
2-methyl-N-[2-(4-methylpentan-2-yl)phenyl]-5-(trifluoromethyl)triazole-4-carboxamide (PubChem CID 142672745) has the molecular formula C17H21F3N4O and a molecular weight of 354.38 g/mol. Its IUPAC name is 2-methyl-N-[2-(4-methylpentan-2-yl)phenyl]-5-(trifluoromethyl)triazole-4-carboxamide.
| Compound Name | 2-methyl-N-[2-(4-methylpentan-2-yl)phenyl]-5-(trifluoromethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 142672745 |
| Molecular Formula | C17H21F3N4O |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-methyl-N-[2-(4-methylpentan-2-yl)phenyl]-5-(trifluoromethyl)triazole-4-carboxamide |
| SMILES | CC(C)CC(C)c1ccccc1NC(=O)c1nn(C)nc1C(F)(F)F |
| InChI | InChI=1S/C17H21F3N4O/c1-10(2)9-11(3)12-7-5-6-8-13(12)21-16(25)14-15(17(18,19)20)23-24(4)22-14/h5-8,10-11H,9H2,1-4H3,(H,21,25) |
| InChIKey | MVDZPOQJFLOXLR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |