C17H22FN3O — CID 141244949
5-fluoro-1-methyl-N-[2-(4-methylpentan-2-yl)phenyl]pyrazole-4-carboxamide (PubChem CID 141244949) has the molecular formula C17H22FN3O and a molecular weight of 303.38 g/mol. Its IUPAC name is 5-fluoro-1-methyl-N-[2-(4-methylpentan-2-yl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-fluoro-1-methyl-N-[2-(4-methylpentan-2-yl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 141244949 |
| Molecular Formula | C17H22FN3O |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 5-fluoro-1-methyl-N-[2-(4-methylpentan-2-yl)phenyl]pyrazole-4-carboxamide |
| SMILES | CC(C)CC(C)c1ccccc1NC(=O)c1cnn(C)c1F |
| InChI | InChI=1S/C17H22FN3O/c1-11(2)9-12(3)13-7-5-6-8-15(13)20-17(22)14-10-19-21(4)16(14)18/h5-8,10-12H,9H2,1-4H3,(H,20,22) |
| InChIKey | VWBYBFSRXFXZOY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |