C19H26N2S — CID 21051584
1,4-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]pyrrole-3-carbothioamide (PubChem CID 21051584) has the molecular formula C19H26N2S and a molecular weight of 314.50 g/mol. Its IUPAC name is 1,4-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]pyrrole-3-carbothioamide.
| Compound Name | 1,4-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]pyrrole-3-carbothioamide |
|---|---|
| PubChem CID | 21051584 |
| Molecular Formula | C19H26N2S |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 1,4-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]pyrrole-3-carbothioamide |
| SMILES | Cc1cn(C)cc1C(=S)Nc1ccccc1C(C)CC(C)C |
| InChI | InChI=1S/C19H26N2S/c1-13(2)10-14(3)16-8-6-7-9-18(16)20-19(22)17-12-21(5)11-15(17)4/h6-9,11-14H,10H2,1-5H3,(H,20,22) |
| InChIKey | NJDXADXBXMYSLF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|