C12H14BrN3O3 — CID 142672803
2-bromo-1-[(2S)-2-(5-cyclopropyl-1,2,4-oxadiazole-3-carbonyl)pyrrolidin-1-yl]ethanone (PubChem CID 142672803) has the molecular formula C12H14BrN3O3 and a molecular weight of 328.17 g/mol. Its IUPAC name is 2-bromo-1-[(2S)-2-(5-cyclopropyl-1,2,4-oxadiazole-3-carbonyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-bromo-1-[(2S)-2-(5-cyclopropyl-1,2,4-oxadiazole-3-carbonyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 142672803 |
| Molecular Formula | C12H14BrN3O3 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 2-bromo-1-[(2S)-2-(5-cyclopropyl-1,2,4-oxadiazole-3-carbonyl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(c1noc(C2CC2)n1)[C@@H]1CCCN1C(=O)CBr |
| InChI | InChI=1S/C12H14BrN3O3/c13-6-9(17)16-5-1-2-8(16)10(18)11-14-12(19-15-11)7-3-4-7/h7-8H,1-6H2/t8-/m0/s1 |
| InChIKey | MLRRKCWOKMTCMM-QMMMGPOBSA-N |
| XLogP | 1.52 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|