C10H12O3 — CID 14267292
4a-hydroperoxy-5,6,7,8-tetrahydronaphthalen-2-one (PubChem CID 14267292) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 4a-hydroperoxy-5,6,7,8-tetrahydronaphthalen-2-one.
| Compound Name | 4a-hydroperoxy-5,6,7,8-tetrahydronaphthalen-2-one |
|---|---|
| PubChem CID | 14267292 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 4a-hydroperoxy-5,6,7,8-tetrahydronaphthalen-2-one |
| SMILES | O=C1C=CC2(OO)CCCCC2=C1 |
| InChI | InChI=1S/C10H12O3/c11-9-4-6-10(13-12)5-2-1-3-8(10)7-9/h4,6-7,12H,1-3,5H2 |
| InChIKey | KICLTNJMICZHGM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|