C10H12O2 — CID 76590836
4a-hydroxy-5,6,7,8-tetrahydronaphthalen-2-one (PubChem CID 76590836) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 4a-hydroxy-5,6,7,8-tetrahydronaphthalen-2-one.
| Compound Name | 4a-hydroxy-5,6,7,8-tetrahydronaphthalen-2-one |
|---|---|
| PubChem CID | 76590836 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 4a-hydroxy-5,6,7,8-tetrahydronaphthalen-2-one |
| SMILES | O=C1C=CC2(O)CCCCC2=C1 |
| InChI | InChI=1S/C10H12O2/c11-9-4-6-10(12)5-2-1-3-8(10)7-9/h4,6-7,12H,1-3,5H2 |
| InChIKey | PWSXGZVMTNIYTP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |