C23H31NO4 — CID 142673464
2-hydroxy-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-4-(4-methylphenyl)butanamide (PubChem CID 142673464) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 2-hydroxy-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-4-(4-methylphenyl)butanamide.
| Compound Name | 2-hydroxy-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-4-(4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 142673464 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 2-hydroxy-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-4-(4-methylphenyl)butanamide |
| SMILES | COc1cc(CCNC(=O)C(O)CCc2ccc(C)cc2)ccc1OC(C)C |
| InChI | InChI=1S/C23H31NO4/c1-16(2)28-21-12-10-19(15-22(21)27-4)13-14-24-23(26)20(25)11-9-18-7-5-17(3)6-8-18/h5-8,10,12,15-16,20,25H,9,11,13-14H2,1-4H3,(H,24,26) |
| InChIKey | NNKWXEGZUIEUII-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |