C24H32FNO4 — CID 142673411
(2R)-2-ethoxy-4-(4-fluorophenyl)-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]butanamide (PubChem CID 142673411) has the molecular formula C24H32FNO4 and a molecular weight of 417.52 g/mol. Its IUPAC name is (2R)-2-ethoxy-4-(4-fluorophenyl)-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]butanamide.
| Compound Name | (2R)-2-ethoxy-4-(4-fluorophenyl)-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 142673411 |
| Molecular Formula | C24H32FNO4 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (2R)-2-ethoxy-4-(4-fluorophenyl)-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]butanamide |
| SMILES | CCO[C@H](CCc1ccc(F)cc1)C(=O)NCCc1ccc(OC(C)C)c(OC)c1 |
| InChI | InChI=1S/C24H32FNO4/c1-5-29-22(13-8-18-6-10-20(25)11-7-18)24(27)26-15-14-19-9-12-21(30-17(2)3)23(16-19)28-4/h6-7,9-12,16-17,22H,5,8,13-15H2,1-4H3,(H,26,27)/t22-/m1/s1 |
| InChIKey | MGQIDZJRUGPQEW-JOCHJYFZSA-N |
| XLogP | 4.32 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |