C23H31NO5 — CID 142673517
(2R)-2-ethoxy-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-3-phenoxypropanamide (PubChem CID 142673517) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is (2R)-2-ethoxy-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-3-phenoxypropanamide.
| Compound Name | (2R)-2-ethoxy-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 142673517 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | (2R)-2-ethoxy-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-3-phenoxypropanamide |
| SMILES | CCO[C@H](COc1ccccc1)C(=O)NCCc1ccc(OC(C)C)c(OC)c1 |
| InChI | InChI=1S/C23H31NO5/c1-5-27-22(16-28-19-9-7-6-8-10-19)23(25)24-14-13-18-11-12-20(29-17(2)3)21(15-18)26-4/h6-12,15,17,22H,5,13-14,16H2,1-4H3,(H,24,25)/t22-/m1/s1 |
| InChIKey | AOCDMSSZDUCYQD-JOCHJYFZSA-N |
| XLogP | 3.63 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |